| Name | 3,4-Bis(3-indolyl)maleimide |
| Synonyms | RO 31-6233 3,4-BIS(3-INDOLYL)MALEIMIDE 3,4-Bis(3-indolyl)maleimide 2,3-BIS(1H-INDOL-3-YL)MALEIMIDE Bisindolylmaleimide IV (Arcyriarubin A) 3,4-Di-1H-indol-3-yl-1H-pyrrole-2,5-dione 1,3-di(1H-indol-2-yl)-1H-pyrrole-2,5-dione 1H-Pyrrole-2,5-dione, 3,4-di-1H-indol-3-yl- 3,4-BIS(3-INDOLYL)MALEIMIDE (ARCYRIARUBIN A). 3-(1H-Indole-3-yl)-4-(1H-indole-3-yl)-1H-pyrrole-2,5-dione |
| CAS | 119139-23-0 |
| InChI | InChI=1/C20H13N3O2/c24-19-11-14(17-9-12-5-1-3-7-15(12)21-17)20(25)23(19)18-10-13-6-2-4-8-16(13)22-18/h1-11,21-22H |
| Molecular Formula | C20H13N3O2 |
| Molar Mass | 327.34 |
| Density | 1.486±0.06 g/cm3(Predicted) |
| Melting Point | 161 °C |
| Boling Point | 690.1±55.0 °C(Predicted) |
| Flash Point | 345.638°C |
| Solubility | DMSO: soluble |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Dark red solid |
| Color | dark red |
| pKa | 8.44±0.60(Predicted) |
| Storage Condition | -20°C |
| Refractive Index | 1.829 |
| In vitro study | Bisindolylmaleimide IV (Arcyriarubin A) inhibits PKC with an IC 50 of 0.1 μM in 1 % DMSO, while the IC 50 of 0.55 μM in 10 % DMSO. |
| WGK Germany | 3 |
| Biological activity | Bisindolylmaleimide IV (Arcyriarubin A) is a potent protein kinase C (PKC) inhibitor with an IC50 range of 0.1-0.55 μM. Bisindolylmaleimide IV also inhibited PKA (IC50=3.1-11.8 μM). Bisindolylmaleimide IV is a potent inhibitor of human cytomegalovirus (HCMV) replication in cell culture with an IC50 of 0.2 μM. |
| target | PKC 0.1-0.55 μ m (IC 50 ) HCMV 0.2 μ m (IC 50 ) |
| in vitro study | Bisindolylmaleimide IV (Arcyriarubin A) inhibits PKC with an IC 50 of 0.1 μM in 1% DMSO, while the IC 50 of 0.55 μM in 10% DMSO. |